C22H27ClN2O3S — CID 46870538
1-[(3-chlorophenyl)methyl]-7-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 46870538) has the molecular formula C22H27ClN2O3S and a molecular weight of 434.99 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-7-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-7-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 46870538 |
| Molecular Formula | C22H27ClN2O3S |
| Molecular Weight | 434.99 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-7-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethoxy]-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | NC1CCc2ccc(OCCN3CCCS3(=O)=O)cc2C1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H27ClN2O3S/c23-18-4-1-3-16(13-18)14-21-20-15-19(7-5-17(20)6-8-22(21)24)28-11-10-25-9-2-12-29(25,26)27/h1,3-5,7,13,15,21-22H,2,6,8-12,14,24H2 |
| InChIKey | PLNRNWCBXKAVPU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.99 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |