About N-ethyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide
N-ethyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 46870652) has the molecular formula C12H14N2O3S
and a molecular weight of 266.32 g/mol. Its IUPAC name is N-ethyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
| PubChem CID | 46870652 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | N-ethyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | CCNC(=O)C1=Cc2ccccc2S(=O)(=O)N1C |
| InChI | InChI=1S/C12H14N2O3S/c1-3-13-12(15)10-8-9-6-4-5-7-11(9)18(16,17)14(10)2/h4-8H,3H2,1-2H3,(H,13,15) |
| InChIKey | NDBQNXYMXBMADG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide?
The IUPAC name of N-ethyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide (CID 46870652) is N-ethyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide.
What is the SMILES notation for N-ethyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide?
The canonical SMILES for N-ethyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide is CCNC(=O)C1=Cc2ccccc2S(=O)(=O)N1C.
What is the InChIKey of N-ethyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide?
The InChIKey is NDBQNXYMXBMADG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O3S/c1-3-13-12(15)10-8-9-6-4-5-7-11(9)18(16,17)14(10)2/h4-8H,3H2,1-2H3,(H,13,15).
What are the key properties of N-ethyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide?
N-ethyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide has a molecular weight of 266.32 g/mol, XLogP of 0.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide is sourced from PubChem (CID 46870652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).