About N-cyclopropyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide
N-cyclopropyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 46870657) has the molecular formula C13H14N2O3S
and a molecular weight of 278.33 g/mol. Its IUPAC name is N-cyclopropyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
| PubChem CID | 46870657 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | N-cyclopropyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | CN1C(C(=O)NC2CC2)=Cc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C13H14N2O3S/c1-15-11(13(16)14-10-6-7-10)8-9-4-2-3-5-12(9)19(15,17)18/h2-5,8,10H,6-7H2,1H3,(H,14,16) |
| InChIKey | ZYXDQESRHPXCGX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopropyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide?
The IUPAC name of N-cyclopropyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide (CID 46870657) is N-cyclopropyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide.
What is the SMILES notation for N-cyclopropyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide?
The canonical SMILES for N-cyclopropyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide is CN1C(C(=O)NC2CC2)=Cc2ccccc2S1(=O)=O.
What is the InChIKey of N-cyclopropyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide?
The InChIKey is ZYXDQESRHPXCGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3S/c1-15-11(13(16)14-10-6-7-10)8-9-4-2-3-5-12(9)19(15,17)18/h2-5,8,10H,6-7H2,1H3,(H,14,16).
What are the key properties of N-cyclopropyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide?
N-cyclopropyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide has a molecular weight of 278.33 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide is sourced from PubChem (CID 46870657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).