C26H21N3O3S — CID 46870676
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-(2-phenyl-1,3-thiazol-4-yl)benzamide (PubChem CID 46870676) has the molecular formula C26H21N3O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-(2-phenyl-1,3-thiazol-4-yl)benzamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-(2-phenyl-1,3-thiazol-4-yl)benzamide |
|---|---|
| PubChem CID | 46870676 |
| Molecular Formula | C26H21N3O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-(2-phenyl-1,3-thiazol-4-yl)benzamide |
| SMILES | NC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1ccccc1-c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C26H21N3O3S/c27-24(31)23(30)21(15-17-9-3-1-4-10-17)28-25(32)20-14-8-7-13-19(20)22-16-33-26(29-22)18-11-5-2-6-12-18/h1-14,16,21H,15H2,(H2,27,31)(H,28,32) |
| InChIKey | LFZBGLILWDTWBK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|