C22H22N4O3S — CID 46870767
N-(1-amino-1,2-dioxoheptan-3-yl)-2-(2-phenyl-1,3-thiazol-4-yl)pyridine-3-carboxamide (PubChem CID 46870767) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-(1-amino-1,2-dioxoheptan-3-yl)-2-(2-phenyl-1,3-thiazol-4-yl)pyridine-3-carboxamide.
| Compound Name | N-(1-amino-1,2-dioxoheptan-3-yl)-2-(2-phenyl-1,3-thiazol-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46870767 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-(1-amino-1,2-dioxoheptan-3-yl)-2-(2-phenyl-1,3-thiazol-4-yl)pyridine-3-carboxamide |
| SMILES | CCCCC(NC(=O)c1cccnc1-c1csc(-c2ccccc2)n1)C(=O)C(N)=O |
| InChI | InChI=1S/C22H22N4O3S/c1-2-3-11-16(19(27)20(23)28)25-21(29)15-10-7-12-24-18(15)17-13-30-22(26-17)14-8-5-4-6-9-14/h4-10,12-13,16H,2-3,11H2,1H3,(H2,23,28)(H,25,29) |
| InChIKey | QSVMHCCIIRLTCQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|