About 1'-(cyclopropylmethyl)-5'-(4-fluorobenzoyl)spiro[1,3-dioxane-2,3'-indole]-2'-one
1'-(cyclopropylmethyl)-5'-(4-fluorobenzoyl)spiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 46871263) has the molecular formula C22H20FNO4
and a molecular weight of 381.40 g/mol. Its IUPAC name is 1'-(cyclopropylmethyl)-5'-(4-fluorobenzoyl)spiro[1,3-dioxane-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 1'-(cyclopropylmethyl)-5'-(4-fluorobenzoyl)spiro[1,3-dioxane-2,3'-indole]-2'-one |
| PubChem CID | 46871263 |
| Molecular Formula | C22H20FNO4 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 1'-(cyclopropylmethyl)-5'-(4-fluorobenzoyl)spiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | O=C(c1ccc(F)cc1)c1ccc2c(c1)C1(OCCCO1)C(=O)N2CC1CC1 |
| InChI | InChI=1S/C22H20FNO4/c23-17-7-4-15(5-8-17)20(25)16-6-9-19-18(12-16)22(27-10-1-11-28-22)21(26)24(19)13-14-2-3-14/h4-9,12,14H,1-3,10-11,13H2 |
| InChIKey | FYCUGSPALHXEAW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1'-(cyclopropylmethyl)-5'-(4-fluorobenzoyl)spiro[1,3-dioxane-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(cyclopropylmethyl)-5'-(4-fluorobenzoyl)spiro[1,3-dioxane-2,3'-indole]-2'-one?
The IUPAC name of 1'-(cyclopropylmethyl)-5'-(4-fluorobenzoyl)spiro[1,3-dioxane-2,3'-indole]-2'-one (CID 46871263) is 1'-(cyclopropylmethyl)-5'-(4-fluorobenzoyl)spiro[1,3-dioxane-2,3'-indole]-2'-one.
What is the SMILES notation for 1'-(cyclopropylmethyl)-5'-(4-fluorobenzoyl)spiro[1,3-dioxane-2,3'-indole]-2'-one?
The canonical SMILES for 1'-(cyclopropylmethyl)-5'-(4-fluorobenzoyl)spiro[1,3-dioxane-2,3'-indole]-2'-one is O=C(c1ccc(F)cc1)c1ccc2c(c1)C1(OCCCO1)C(=O)N2CC1CC1.
What is the InChIKey of 1'-(cyclopropylmethyl)-5'-(4-fluorobenzoyl)spiro[1,3-dioxane-2,3'-indole]-2'-one?
The InChIKey is FYCUGSPALHXEAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20FNO4/c23-17-7-4-15(5-8-17)20(25)16-6-9-19-18(12-16)22(27-10-1-11-28-22)21(26)24(19)13-14-2-3-14/h4-9,12,14H,1-3,10-11,13H2.
What are the key properties of 1'-(cyclopropylmethyl)-5'-(4-fluorobenzoyl)spiro[1,3-dioxane-2,3'-indole]-2'-one?
1'-(cyclopropylmethyl)-5'-(4-fluorobenzoyl)spiro[1,3-dioxane-2,3'-indole]-2'-one has a molecular weight of 381.40 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(cyclopropylmethyl)-5'-(4-fluorobenzoyl)spiro[1,3-dioxane-2,3'-indole]-2'-one is sourced from PubChem (CID 46871263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).