C32H29N7O2 — CID 46871486
benzyl 4-[4-[[4-[3-(cyanomethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate (PubChem CID 46871486) has the molecular formula C32H29N7O2 and a molecular weight of 543.63 g/mol. Its IUPAC name is benzyl 4-[4-[[4-[3-(cyanomethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[4-[[4-[3-(cyanomethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46871486 |
| Molecular Formula | C32H29N7O2 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | benzyl 4-[4-[[4-[3-(cyanomethyl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]piperazine-1-carboxylate |
| SMILES | N#CCc1cccc(-c2nc(Nc3ccc(N4CCN(C(=O)OCc5ccccc5)CC4)cc3)nc3[nH]ccc23)c1 |
| InChI | InChI=1S/C32H29N7O2/c33-15-13-23-7-4-8-25(21-23)29-28-14-16-34-30(28)37-31(36-29)35-26-9-11-27(12-10-26)38-17-19-39(20-18-38)32(40)41-22-24-5-2-1-3-6-24/h1-12,14,16,21H,13,17-20,22H2,(H2,34,35,36,37) |
| InChIKey | SJPPAZWMRQSVBA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|