C18H23FN4O4 — CID 46871615
(2S)-N-(5-fluoro-2-pyridinyl)-1-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-2,5-dihydropyrrole-2-carboxamide (PubChem CID 46871615) has the molecular formula C18H23FN4O4 and a molecular weight of 378.40 g/mol. Its IUPAC name is (2S)-N-(5-fluoro-2-pyridinyl)-1-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-2,5-dihydropyrrole-2-carboxamide.
| Compound Name | (2S)-N-(5-fluoro-2-pyridinyl)-1-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-2,5-dihydropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 46871615 |
| Molecular Formula | C18H23FN4O4 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (2S)-N-(5-fluoro-2-pyridinyl)-1-[(2R)-2-[[formyl(hydroxy)amino]methyl]hexanoyl]-2,5-dihydropyrrole-2-carboxamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)N1CC=C[C@H]1C(=O)Nc1ccc(F)cn1 |
| InChI | InChI=1S/C18H23FN4O4/c1-2-3-5-13(11-22(27)12-24)18(26)23-9-4-6-15(23)17(25)21-16-8-7-14(19)10-20-16/h4,6-8,10,12-13,15,27H,2-3,5,9,11H2,1H3,(H,20,21,25)/t13-,15+/m1/s1 |
| InChIKey | ZNOIFQQEENBQJV-HIFRSBDPSA-N |
| XLogP | 1.58 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|