C22H19F8NO5S2 — CID 46871758
N-[[(6aR,7R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 46871758) has the molecular formula C22H19F8NO5S2 and a molecular weight of 593.51 g/mol. Its IUPAC name is N-[[(6aR,7R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[[(6aR,7R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 46871758 |
| Molecular Formula | C22H19F8NO5S2 |
| Molecular Weight | 593.51 g/mol |
| Exact Mass | 593.06 |
| IUPAC Name | N-[[(6aR,7R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(NC[C@@H]1CCC[C@@]2(S(=O)(=O)c3ccc(C(F)(F)F)cc3)c3c(F)ccc(F)c3OC[C@@H]12)C(F)(F)F |
| InChI | InChI=1S/C22H19F8NO5S2/c23-16-7-8-17(24)19-18(16)20(37(32,33)14-5-3-13(4-6-14)21(25,26)27)9-1-2-12(15(20)11-36-19)10-31-38(34,35)22(28,29)30/h3-8,12,15,31H,1-2,9-11H2/t12-,15-,20-/m0/s1 |
| InChIKey | VFLOCXPTWZLDFY-LCMPSIMXSA-N |
| XLogP | 4.90 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |