C17H20N2O4S — CID 46871889
4-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)benzenesulfonamide (PubChem CID 46871889) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)benzenesulfonamide.
| Compound Name | 4-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 46871889 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 4-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)benzenesulfonamide |
| SMILES | COc1cc2c(cc1OC)C(c1ccc(S(N)(=O)=O)cc1)NCC2 |
| InChI | InChI=1S/C17H20N2O4S/c1-22-15-9-12-7-8-19-17(14(12)10-16(15)23-2)11-3-5-13(6-4-11)24(18,20)21/h3-6,9-10,17,19H,7-8H2,1-2H3,(H2,18,20,21) |
| InChIKey | ILYZTAPALYJTGK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |