C23H33N7 — CID 46871968
3-benzyl-6-decyliminoimidazo[4,5-e][1,3]diazepine-4,8-diamine (PubChem CID 46871968) has the molecular formula C23H33N7 and a molecular weight of 407.57 g/mol. Its IUPAC name is 3-benzyl-6-decyliminoimidazo[4,5-e][1,3]diazepine-4,8-diamine.
| Compound Name | 3-benzyl-6-decyliminoimidazo[4,5-e][1,3]diazepine-4,8-diamine |
|---|---|
| PubChem CID | 46871968 |
| Molecular Formula | C23H33N7 |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 3-benzyl-6-decyliminoimidazo[4,5-e][1,3]diazepine-4,8-diamine |
| SMILES | CCCCCCCCCC/N=c1\nc(N)c2ncn(Cc3ccccc3)c2c(N)n1 |
| InChI | InChI=1S/C23H33N7/c1-2-3-4-5-6-7-8-12-15-26-23-28-21(24)19-20(22(25)29-23)30(17-27-19)16-18-13-10-9-11-14-18/h9-11,13-14,17H,2-8,12,15-16H2,1H3,(H4,24,25,26,28,29) |
| InChIKey | HUNOHOMZKVHJFC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|