C32H30O6 — CID 46871974
(1S,2S)-1,2-bis[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]ethane-1,2-diol (PubChem CID 46871974) has the molecular formula C32H30O6 and a molecular weight of 510.59 g/mol. Its IUPAC name is (1S,2S)-1,2-bis[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]ethane-1,2-diol.
| Compound Name | (1S,2S)-1,2-bis[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 46871974 |
| Molecular Formula | C32H30O6 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | (1S,2S)-1,2-bis[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]ethane-1,2-diol |
| SMILES | O[C@@H]([C@H](O)[C@H]1COC(c2ccccc2)(c2ccccc2)O1)[C@H]1COC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C32H30O6/c33-29(27-21-35-31(37-27,23-13-5-1-6-14-23)24-15-7-2-8-16-24)30(34)28-22-36-32(38-28,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20,27-30,33-34H,21-22H2/t27-,28-,29-,30-/m1/s1 |
| InChIKey | JYYZLBSVMGEBAY-SKKKGAJSSA-N |
| XLogP | 4.34 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |