C19H27N5O4S — CID 46872070
1-[5-(5,6-dimethoxy-3-pyridinyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-(2-propoxyethyl)urea (PubChem CID 46872070) has the molecular formula C19H27N5O4S and a molecular weight of 421.52 g/mol. Its IUPAC name is 1-[5-(5,6-dimethoxy-3-pyridinyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-(2-propoxyethyl)urea.
| Compound Name | 1-[5-(5,6-dimethoxy-3-pyridinyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-(2-propoxyethyl)urea |
|---|---|
| PubChem CID | 46872070 |
| Molecular Formula | C19H27N5O4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 1-[5-(5,6-dimethoxy-3-pyridinyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]-3-(2-propoxyethyl)urea |
| SMILES | CCCOCCNC(=O)Nc1nc2c(s1)CN(c1cnc(OC)c(OC)c1)CC2 |
| InChI | InChI=1S/C19H27N5O4S/c1-4-8-28-9-6-20-18(25)23-19-22-14-5-7-24(12-16(14)29-19)13-10-15(26-2)17(27-3)21-11-13/h10-11H,4-9,12H2,1-3H3,(H2,20,22,23,25) |
| InChIKey | JWJNQKXVNWLNIV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|