C28H27NO4 — CID 46872083
benzyl (6S)-6-[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 46872083) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is benzyl (6S)-6-[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | benzyl (6S)-6-[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 46872083 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | benzyl (6S)-6-[(4S)-2,2-diphenyl-1,3-dioxolan-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC=C[C@H]1[C@H]1COC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C28H27NO4/c30-27(31-20-22-12-4-1-5-13-22)29-19-11-10-18-25(29)26-21-32-28(33-26,23-14-6-2-7-15-23)24-16-8-3-9-17-24/h1-10,12-18,25-26H,11,19-21H2/t25-,26+/m0/s1 |
| InChIKey | CPGANVGPBGBOHQ-IZZNHLLZSA-N |
| XLogP | 5.27 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|