C25H26F3NO5 — CID 46872168
(E)-1-[4-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine (PubChem CID 46872168) has the molecular formula C25H26F3NO5 and a molecular weight of 477.48 g/mol. Its IUPAC name is (E)-1-[4-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine.
| Compound Name | (E)-1-[4-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine |
|---|---|
| PubChem CID | 46872168 |
| Molecular Formula | C25H26F3NO5 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | (E)-1-[4-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]-N-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxymethanimine |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](O/N=C/c2ccc(C#Cc3ccc(C(F)(F)F)cc3)cc2)[C@@H]1OC |
| InChI | InChI=1S/C25H26F3NO5/c1-16-21(30-2)22(31-3)23(32-4)24(33-16)34-29-15-19-9-7-17(8-10-19)5-6-18-11-13-20(14-12-18)25(26,27)28/h7-16,21-24H,1-4H3/b29-15+/t16-,21-,22+,23+,24-/m0/s1 |
| InChIKey | XPNZEDUMFBZPQZ-NWLKLPGMSA-N |
| XLogP | 4.25 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|