C20H23N4O7PS — CID 46872368
(2R,3R,4R,5R)-2-(4-aminothieno[3,4-d]pyrimidin-7-yl)-3-methyl-5-[[(4S)-2-oxo-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolane-3,4-diol (PubChem CID 46872368) has the molecular formula C20H23N4O7PS and a molecular weight of 494.47 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(4-aminothieno[3,4-d]pyrimidin-7-yl)-3-methyl-5-[[(4S)-2-oxo-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-(4-aminothieno[3,4-d]pyrimidin-7-yl)-3-methyl-5-[[(4S)-2-oxo-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 46872368 |
| Molecular Formula | C20H23N4O7PS |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | (2R,3R,4R,5R)-2-(4-aminothieno[3,4-d]pyrimidin-7-yl)-3-methyl-5-[[(4S)-2-oxo-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](COP2(=O)OCC[C@@H](c3ccncc3)O2)O[C@H]1c1scc2c(N)ncnc12 |
| InChI | InChI=1S/C20H23N4O7PS/c1-20(26)17(25)14(30-18(20)16-15-12(9-33-16)19(21)24-10-23-15)8-29-32(27)28-7-4-13(31-32)11-2-5-22-6-3-11/h2-3,5-6,9-10,13-14,17-18,25-26H,4,7-8H2,1H3,(H2,21,23,24)/t13-,14+,17+,18-,20+,32?/m0/s1 |
| InChIKey | WECJJMOQMIZYPH-WIKCWBCKSA-N |
| XLogP | 2.52 |
| TPSA | 159.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|