C14H13N3 — CID 46872427
anthracene-2,9,10-triamine (PubChem CID 46872427) has the molecular formula C14H13N3 and a molecular weight of 223.28 g/mol. Its IUPAC name is anthracene-2,9,10-triamine.
| Compound Name | anthracene-2,9,10-triamine |
|---|---|
| PubChem CID | 46872427 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | anthracene-2,9,10-triamine |
| SMILES | Nc1ccc2c(N)c3ccccc3c(N)c2c1 |
| InChI | InChI=1S/C14H13N3/c15-8-5-6-11-12(7-8)14(17)10-4-2-1-3-9(10)13(11)16/h1-7H,15-17H2 |
| InChIKey | IEYFLQUHUBVMFY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|