C15H26O3 — CID 46872468
(1S,3aR,4R,7S)-7-(hydroxymethyl)-2,2,4,8-tetramethyl-1,3,3a,5,6,7-hexahydroazulene-1,4-diol (PubChem CID 46872468) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1S,3aR,4R,7S)-7-(hydroxymethyl)-2,2,4,8-tetramethyl-1,3,3a,5,6,7-hexahydroazulene-1,4-diol.
| Compound Name | (1S,3aR,4R,7S)-7-(hydroxymethyl)-2,2,4,8-tetramethyl-1,3,3a,5,6,7-hexahydroazulene-1,4-diol |
|---|---|
| PubChem CID | 46872468 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1S,3aR,4R,7S)-7-(hydroxymethyl)-2,2,4,8-tetramethyl-1,3,3a,5,6,7-hexahydroazulene-1,4-diol |
| SMILES | CC1=C2[C@@H](O)C(C)(C)C[C@H]2[C@](C)(O)CC[C@@H]1CO |
| InChI | InChI=1S/C15H26O3/c1-9-10(8-16)5-6-15(4,18)11-7-14(2,3)13(17)12(9)11/h10-11,13,16-18H,5-8H2,1-4H3/t10-,11-,13-,15-/m1/s1 |
| InChIKey | KAHAKMSPIVIBRW-NLRBGTRBSA-N |
| XLogP | 1.86 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|