C17H33IO2Si — CID 46872554
(Z,2R,4S,5R,6S)-8-iodo-2,4,6-trimethyl-5-triethylsilyloxyoct-7-enal (PubChem CID 46872554) has the molecular formula C17H33IO2Si and a molecular weight of 424.44 g/mol. Its IUPAC name is (Z,2R,4S,5R,6S)-8-iodo-2,4,6-trimethyl-5-triethylsilyloxyoct-7-enal.
| Compound Name | (Z,2R,4S,5R,6S)-8-iodo-2,4,6-trimethyl-5-triethylsilyloxyoct-7-enal |
|---|---|
| PubChem CID | 46872554 |
| Molecular Formula | C17H33IO2Si |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (Z,2R,4S,5R,6S)-8-iodo-2,4,6-trimethyl-5-triethylsilyloxyoct-7-enal |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@@H](C)/C=C\I)[C@@H](C)CC(C)C=O |
| InChI | InChI=1S/C17H33IO2Si/c1-7-21(8-2,9-3)20-17(15(5)10-11-18)16(6)12-14(4)13-19/h10-11,13-17H,7-9,12H2,1-6H3/b11-10-/t14?,15-,16-,17-/m0/s1 |
| InChIKey | ZSGFOXRDAJNZFG-LEWHQODDSA-N |
| XLogP | 5.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|