C20H28O3 — CID 46872826
(1R,4R,5S,6E,10S,12S)-7,12-dimethyl-4-propan-2-yl-11,15-dioxatetracyclo[12.2.1.01,5.010,12]heptadeca-6,14(17)-dien-16-one (PubChem CID 46872826) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1R,4R,5S,6E,10S,12S)-7,12-dimethyl-4-propan-2-yl-11,15-dioxatetracyclo[12.2.1.01,5.010,12]heptadeca-6,14(17)-dien-16-one.
| Compound Name | (1R,4R,5S,6E,10S,12S)-7,12-dimethyl-4-propan-2-yl-11,15-dioxatetracyclo[12.2.1.01,5.010,12]heptadeca-6,14(17)-dien-16-one |
|---|---|
| PubChem CID | 46872826 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1R,4R,5S,6E,10S,12S)-7,12-dimethyl-4-propan-2-yl-11,15-dioxatetracyclo[12.2.1.01,5.010,12]heptadeca-6,14(17)-dien-16-one |
| SMILES | C/C1=C/[C@@H]2[C@@H](C(C)C)CC[C@]23C=C(C[C@]2(C)O[C@H]2CC1)OC3=O |
| InChI | InChI=1S/C20H28O3/c1-12(2)15-7-8-20-11-14(22-18(20)21)10-19(4)17(23-19)6-5-13(3)9-16(15)20/h9,11-12,15-17H,5-8,10H2,1-4H3/b13-9-/t15-,16-,17+,19+,20+/m1/s1 |
| InChIKey | JRPGEZVMIUIJJZ-ZYNGHYNBSA-N |
| XLogP | 4.38 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|