C13H16FN3O3S — CID 46872847
(2R,3R,4R,5R)-5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-2-(hydroxymethyl)-4,5-dimethyloxolan-3-ol (PubChem CID 46872847) has the molecular formula C13H16FN3O3S and a molecular weight of 313.35 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-2-(hydroxymethyl)-4,5-dimethyloxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-2-(hydroxymethyl)-4,5-dimethyloxolan-3-ol |
|---|---|
| PubChem CID | 46872847 |
| Molecular Formula | C13H16FN3O3S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (2R,3R,4R,5R)-5-(4-aminothieno[3,4-d]pyrimidin-7-yl)-4-fluoro-2-(hydroxymethyl)-4,5-dimethyloxolan-3-ol |
| SMILES | C[C@@]1(c2scc3c(N)ncnc23)O[C@H](CO)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C13H16FN3O3S/c1-12(14)9(19)7(3-18)20-13(12,2)10-8-6(4-21-10)11(15)17-5-16-8/h4-5,7,9,18-19H,3H2,1-2H3,(H2,15,16,17)/t7-,9-,12-,13+/m1/s1 |
| InChIKey | ZHXBMLLEEKPHMX-HLXLPKMUSA-N |
| XLogP | 0.97 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |