C30H28N2O6 — CID 46873195
4-methoxy-3-(3-methoxyphenyl)-N-[8-methyl-2-oxo-7-(1,2,3,6-tetrahydropyridin-3-yloxy)chromen-3-yl]benzamide (PubChem CID 46873195) has the molecular formula C30H28N2O6 and a molecular weight of 512.56 g/mol. Its IUPAC name is 4-methoxy-3-(3-methoxyphenyl)-N-[8-methyl-2-oxo-7-(1,2,3,6-tetrahydropyridin-3-yloxy)chromen-3-yl]benzamide.
| Compound Name | 4-methoxy-3-(3-methoxyphenyl)-N-[8-methyl-2-oxo-7-(1,2,3,6-tetrahydropyridin-3-yloxy)chromen-3-yl]benzamide |
|---|---|
| PubChem CID | 46873195 |
| Molecular Formula | C30H28N2O6 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 4-methoxy-3-(3-methoxyphenyl)-N-[8-methyl-2-oxo-7-(1,2,3,6-tetrahydropyridin-3-yloxy)chromen-3-yl]benzamide |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3cc4ccc(OC5C=CCNC5)c(C)c4oc3=O)ccc2OC)c1 |
| InChI | InChI=1S/C30H28N2O6/c1-18-26(37-23-8-5-13-31-17-23)11-9-20-16-25(30(34)38-28(18)20)32-29(33)21-10-12-27(36-3)24(15-21)19-6-4-7-22(14-19)35-2/h4-12,14-16,23,31H,13,17H2,1-3H3,(H,32,33) |
| InChIKey | KKIDKAVGGAJLSP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|