About 6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4H-1,4-benzoxazin-3-one
6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4H-1,4-benzoxazin-3-one (PubChem CID 46873288) has the molecular formula C23H29N3O4
and a molecular weight of 411.50 g/mol. Its IUPAC name is 6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4H-1,4-benzoxazin-3-one |
| PubChem CID | 46873288 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1ccccc1N1CCN(CCCCOc2ccc3c(c2)NC(=O)CO3)CC1 |
| InChI | InChI=1S/C23H29N3O4/c1-28-22-7-3-2-6-20(22)26-13-11-25(12-14-26)10-4-5-15-29-18-8-9-21-19(16-18)24-23(27)17-30-21/h2-3,6-9,16H,4-5,10-15,17H2,1H3,(H,24,27) |
| InChIKey | ZQIBMJPPTOOPCH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4H-1,4-benzoxazin-3-one?
The IUPAC name of 6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4H-1,4-benzoxazin-3-one (CID 46873288) is 6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4H-1,4-benzoxazin-3-one is COc1ccccc1N1CCN(CCCCOc2ccc3c(c2)NC(=O)CO3)CC1.
What is the InChIKey of 6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4H-1,4-benzoxazin-3-one?
The InChIKey is ZQIBMJPPTOOPCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29N3O4/c1-28-22-7-3-2-6-20(22)26-13-11-25(12-14-26)10-4-5-15-29-18-8-9-21-19(16-18)24-23(27)17-30-21/h2-3,6-9,16H,4-5,10-15,17H2,1H3,(H,24,27).
What are the key properties of 6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4H-1,4-benzoxazin-3-one?
6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4H-1,4-benzoxazin-3-one has a molecular weight of 411.50 g/mol, XLogP of 3.01, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 46873288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).