C14H15ClN2 — CID 46873318
2-chloro-8-methyl-6,7,9,10-tetrahydropyrido[2,3-h][3]benzazepine (PubChem CID 46873318) has the molecular formula C14H15ClN2 and a molecular weight of 246.74 g/mol. Its IUPAC name is 2-chloro-8-methyl-6,7,9,10-tetrahydropyrido[2,3-h][3]benzazepine.
| Compound Name | 2-chloro-8-methyl-6,7,9,10-tetrahydropyrido[2,3-h][3]benzazepine |
|---|---|
| PubChem CID | 46873318 |
| Molecular Formula | C14H15ClN2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-chloro-8-methyl-6,7,9,10-tetrahydropyrido[2,3-h][3]benzazepine |
| SMILES | CN1CCc2cc3ccc(Cl)nc3cc2CC1 |
| InChI | InChI=1S/C14H15ClN2/c1-17-6-4-10-8-12-2-3-14(15)16-13(12)9-11(10)5-7-17/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | GRONTXCOGNJHQH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|