C11H13N3 — CID 46873419
1,5,6,7,8,9-hexahydroimidazo[4,5-h][3]benzazepine (PubChem CID 46873419) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 1,5,6,7,8,9-hexahydroimidazo[4,5-h][3]benzazepine.
| Compound Name | 1,5,6,7,8,9-hexahydroimidazo[4,5-h][3]benzazepine |
|---|---|
| PubChem CID | 46873419 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 1,5,6,7,8,9-hexahydroimidazo[4,5-h][3]benzazepine |
| SMILES | c1nc2cc3c(cc2[nH]1)CCNCC3 |
| InChI | InChI=1S/C11H13N3/c1-3-12-4-2-9-6-11-10(5-8(1)9)13-7-14-11/h5-7,12H,1-4H2,(H,13,14) |
| InChIKey | QVXPMLBYVCEIJS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |