C16H19N3O6 — CID 46873529
(2R,3R)-2,3-dihydroxybutanedioic acid;7,8,9,10-tetrahydro-6H-pyrazino[2,3-h][3]benzazepine (PubChem CID 46873529) has the molecular formula C16H19N3O6 and a molecular weight of 349.34 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanedioic acid;7,8,9,10-tetrahydro-6H-pyrazino[2,3-h][3]benzazepine.
| Compound Name | (2R,3R)-2,3-dihydroxybutanedioic acid;7,8,9,10-tetrahydro-6H-pyrazino[2,3-h][3]benzazepine |
|---|---|
| PubChem CID | 46873529 |
| Molecular Formula | C16H19N3O6 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;7,8,9,10-tetrahydro-6H-pyrazino[2,3-h][3]benzazepine |
| SMILES | O=C(O)[C@H](O)[C@@H](O)C(=O)O.c1cnc2cc3c(cc2n1)CCNCC3 |
| InChI | InChI=1S/C12H13N3.C4H6O6/c1-3-13-4-2-10-8-12-11(7-9(1)10)14-5-6-15-12;5-1(3(7)8)2(6)4(9)10/h5-8,13H,1-4H2;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| InChIKey | AVWMXAOLKDPFPK-LREBCSMRSA-N |
| XLogP | -0.80 |
| TPSA | 152.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |