C20H23ClN4O4 — CID 46873881
(3R,4S,5R)-2-[5-chloro-7-(1-phenylpropan-2-ylamino)imidazo[4,5-b]pyridin-3-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 46873881) has the molecular formula C20H23ClN4O4 and a molecular weight of 418.88 g/mol. Its IUPAC name is (3R,4S,5R)-2-[5-chloro-7-(1-phenylpropan-2-ylamino)imidazo[4,5-b]pyridin-3-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-[5-chloro-7-(1-phenylpropan-2-ylamino)imidazo[4,5-b]pyridin-3-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 46873881 |
| Molecular Formula | C20H23ClN4O4 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (3R,4S,5R)-2-[5-chloro-7-(1-phenylpropan-2-ylamino)imidazo[4,5-b]pyridin-3-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC(Cc1ccccc1)Nc1cc(Cl)nc2c1ncn2C1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H23ClN4O4/c1-11(7-12-5-3-2-4-6-12)23-13-8-15(21)24-19-16(13)22-10-25(19)20-18(28)17(27)14(9-26)29-20/h2-6,8,10-11,14,17-18,20,26-28H,7,9H2,1H3,(H,23,24)/t11?,14-,17-,18-,20?/m1/s1 |
| InChIKey | RCLBIIKVOWLZIW-UPHLJAQNSA-N |
| XLogP | 1.74 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|