C8H10F3N3O4S — CID 46874099
4-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 46874099) has the molecular formula C8H10F3N3O4S and a molecular weight of 301.25 g/mol. Its IUPAC name is 4-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 46874099 |
| Molecular Formula | C8H10F3N3O4S |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 4-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | OC[C@H]1OC(n2c(C(F)(F)F)n[nH]c2=S)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H10F3N3O4S/c9-8(10,11)6-12-13-7(19)14(6)5-4(17)3(16)2(1-15)18-5/h2-5,15-17H,1H2,(H,13,19)/t2-,3-,4-,5?/m1/s1 |
| InChIKey | ZDRVZIQPPCDWHW-SOOFDHNKSA-N |
| XLogP | -0.43 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|