C18H20N4O5 — CID 46874229
(3R,4S,5R)-2-[6-(4-ethoxyphenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 46874229) has the molecular formula C18H20N4O5 and a molecular weight of 372.38 g/mol. Its IUPAC name is (3R,4S,5R)-2-[6-(4-ethoxyphenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-[6-(4-ethoxyphenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 46874229 |
| Molecular Formula | C18H20N4O5 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (3R,4S,5R)-2-[6-(4-ethoxyphenyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCOc1ccc(-c2ncnc3c2ncn3C2O[C@H](CO)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C18H20N4O5/c1-2-26-11-5-3-10(4-6-11)13-14-17(20-8-19-13)22(9-21-14)18-16(25)15(24)12(7-23)27-18/h3-6,8-9,12,15-16,18,23-25H,2,7H2,1H3/t12-,15-,16-,18?/m1/s1 |
| InChIKey | IULQPOKHLWSFNZ-CAXZQUKHSA-N |
| XLogP | 0.50 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |