C17H18N4O5 — CID 46874231
(2R,3S,4R)-2-(hydroxymethyl)-5-[6-(4-methoxyphenyl)purin-9-yl]oxolane-3,4-diol (PubChem CID 46874231) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is (2R,3S,4R)-2-(hydroxymethyl)-5-[6-(4-methoxyphenyl)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(hydroxymethyl)-5-[6-(4-methoxyphenyl)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 46874231 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (2R,3S,4R)-2-(hydroxymethyl)-5-[6-(4-methoxyphenyl)purin-9-yl]oxolane-3,4-diol |
| SMILES | COc1ccc(-c2ncnc3c2ncn3C2O[C@H](CO)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C17H18N4O5/c1-25-10-4-2-9(3-5-10)12-13-16(19-7-18-12)21(8-20-13)17-15(24)14(23)11(6-22)26-17/h2-5,7-8,11,14-15,17,22-24H,6H2,1H3/t11-,14-,15-,17?/m1/s1 |
| InChIKey | PTSWVMQWKMAAKK-DMUYAFOSSA-N |
| XLogP | 0.11 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |