C17H19N5O4 — CID 46874334
(2R,3S,4R)-2-(hydroxymethyl)-5-[6-(4-methylanilino)purin-9-yl]oxolane-3,4-diol (PubChem CID 46874334) has the molecular formula C17H19N5O4 and a molecular weight of 357.37 g/mol. Its IUPAC name is (2R,3S,4R)-2-(hydroxymethyl)-5-[6-(4-methylanilino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(hydroxymethyl)-5-[6-(4-methylanilino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 46874334 |
| Molecular Formula | C17H19N5O4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (2R,3S,4R)-2-(hydroxymethyl)-5-[6-(4-methylanilino)purin-9-yl]oxolane-3,4-diol |
| SMILES | Cc1ccc(Nc2ncnc3c2ncn3C2O[C@H](CO)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C17H19N5O4/c1-9-2-4-10(5-3-9)21-15-12-16(19-7-18-15)22(8-20-12)17-14(25)13(24)11(6-23)26-17/h2-5,7-8,11,13-14,17,23-25H,6H2,1H3,(H,18,19,21)/t11-,13-,14-,17?/m1/s1 |
| InChIKey | NCYHIILDKSQWGE-IKYDMHQPSA-N |
| XLogP | 0.49 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |