C9H8N8 — CID 4687475
6-(4-azidophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 4687475) has the molecular formula C9H8N8 and a molecular weight of 228.22 g/mol. Its IUPAC name is 6-(4-azidophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(4-azidophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 4687475 |
| Molecular Formula | C9H8N8 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 6-(4-azidophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | [N-]=[N+]=Nc1ccc(-c2nc(N)nc(N)n2)cc1 |
| InChI | InChI=1S/C9H8N8/c10-8-13-7(14-9(11)15-8)5-1-3-6(4-2-5)16-17-12/h1-4H,(H4,10,11,13,14,15) |
| InChIKey | MJDJEGNNKXTOCG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 139.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|