C11H13IO4S — CID 46875291
(3R,4S,5S)-5-[(4-iodophenyl)sulfanylmethyl]oxolane-2,3,4-triol (PubChem CID 46875291) has the molecular formula C11H13IO4S and a molecular weight of 368.19 g/mol. Its IUPAC name is (3R,4S,5S)-5-[(4-iodophenyl)sulfanylmethyl]oxolane-2,3,4-triol.
| Compound Name | (3R,4S,5S)-5-[(4-iodophenyl)sulfanylmethyl]oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 46875291 |
| Molecular Formula | C11H13IO4S |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | (3R,4S,5S)-5-[(4-iodophenyl)sulfanylmethyl]oxolane-2,3,4-triol |
| SMILES | OC1O[C@H](CSc2ccc(I)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H13IO4S/c12-6-1-3-7(4-2-6)17-5-8-9(13)10(14)11(15)16-8/h1-4,8-11,13-15H,5H2/t8-,9-,10-,11?/m1/s1 |
| InChIKey | CUCAMVFOUAOMBK-QHPFDFDXSA-N |
| XLogP | 0.82 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|