C7H14O4S — CID 46875298
(3R,4S,5S)-5-(ethylsulfanylmethyl)oxolane-2,3,4-triol (PubChem CID 46875298) has the molecular formula C7H14O4S and a molecular weight of 194.25 g/mol. Its IUPAC name is (3R,4S,5S)-5-(ethylsulfanylmethyl)oxolane-2,3,4-triol.
| Compound Name | (3R,4S,5S)-5-(ethylsulfanylmethyl)oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 46875298 |
| Molecular Formula | C7H14O4S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (3R,4S,5S)-5-(ethylsulfanylmethyl)oxolane-2,3,4-triol |
| SMILES | CCSC[C@H]1OC(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H14O4S/c1-2-12-3-4-5(8)6(9)7(10)11-4/h4-10H,2-3H2,1H3/t4-,5-,6-,7?/m1/s1 |
| InChIKey | SSZPLWKWPFPRLF-RKEPMNIXSA-N |
| XLogP | -0.82 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |