C14H16Cl3N3O3 — CID 46875504
(3S,4S)-2-[4,5,6-trichloro-2-(propan-2-ylamino)benzimidazol-1-yl]oxolane-3,4-diol (PubChem CID 46875504) has the molecular formula C14H16Cl3N3O3 and a molecular weight of 380.66 g/mol. Its IUPAC name is (3S,4S)-2-[4,5,6-trichloro-2-(propan-2-ylamino)benzimidazol-1-yl]oxolane-3,4-diol.
| Compound Name | (3S,4S)-2-[4,5,6-trichloro-2-(propan-2-ylamino)benzimidazol-1-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 46875504 |
| Molecular Formula | C14H16Cl3N3O3 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | (3S,4S)-2-[4,5,6-trichloro-2-(propan-2-ylamino)benzimidazol-1-yl]oxolane-3,4-diol |
| SMILES | CC(C)Nc1nc2c(Cl)c(Cl)c(Cl)cc2n1C1OC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H16Cl3N3O3/c1-5(2)18-14-19-11-7(3-6(15)9(16)10(11)17)20(14)13-12(22)8(21)4-23-13/h3,5,8,12-13,21-22H,4H2,1-2H3,(H,18,19)/t8-,12-,13?/m0/s1 |
| InChIKey | HCWRUKNTAABXEC-YNDOSBHVSA-N |
| XLogP | 3.07 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|