C16H21N5O5 — CID 46876117
(2R,3S,4R)-2-(hydroxymethyl)-5-[6-(7-oxabicyclo[4.1.0]heptan-3-ylamino)purin-9-yl]oxolane-3,4-diol (PubChem CID 46876117) has the molecular formula C16H21N5O5 and a molecular weight of 363.37 g/mol. Its IUPAC name is (2R,3S,4R)-2-(hydroxymethyl)-5-[6-(7-oxabicyclo[4.1.0]heptan-3-ylamino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(hydroxymethyl)-5-[6-(7-oxabicyclo[4.1.0]heptan-3-ylamino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 46876117 |
| Molecular Formula | C16H21N5O5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (2R,3S,4R)-2-(hydroxymethyl)-5-[6-(7-oxabicyclo[4.1.0]heptan-3-ylamino)purin-9-yl]oxolane-3,4-diol |
| SMILES | OC[C@H]1OC(n2cnc3c(NC4CCC5OC5C4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H21N5O5/c22-4-10-12(23)13(24)16(26-10)21-6-19-11-14(17-5-18-15(11)21)20-7-1-2-8-9(3-7)25-8/h5-10,12-13,16,22-24H,1-4H2,(H,17,18,20)/t7?,8?,9?,10-,12-,13-,16?/m1/s1 |
| InChIKey | CFLRGHIDXPMZRJ-XPELVCMNSA-N |
| XLogP | -0.83 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|