C35H42N8O5 — CID 46876559
(2S,3S,4R)-5-[6-[2-[1-[(2,5-dimethylphenyl)methyl]indol-3-yl]ethylamino]purin-9-yl]-3,4-dihydroxy-N-(2-morpholin-4-ylethyl)oxolane-2-carboxamide (PubChem CID 46876559) has the molecular formula C35H42N8O5 and a molecular weight of 654.77 g/mol. Its IUPAC name is (2S,3S,4R)-5-[6-[2-[1-[(2,5-dimethylphenyl)methyl]indol-3-yl]ethylamino]purin-9-yl]-3,4-dihydroxy-N-(2-morpholin-4-ylethyl)oxolane-2-carboxamide.
| Compound Name | (2S,3S,4R)-5-[6-[2-[1-[(2,5-dimethylphenyl)methyl]indol-3-yl]ethylamino]purin-9-yl]-3,4-dihydroxy-N-(2-morpholin-4-ylethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 46876559 |
| Molecular Formula | C35H42N8O5 |
| Molecular Weight | 654.77 g/mol |
| Exact Mass | 654.33 |
| IUPAC Name | (2S,3S,4R)-5-[6-[2-[1-[(2,5-dimethylphenyl)methyl]indol-3-yl]ethylamino]purin-9-yl]-3,4-dihydroxy-N-(2-morpholin-4-ylethyl)oxolane-2-carboxamide |
| SMILES | Cc1ccc(C)c(Cn2cc(CCNc3ncnc4c3ncn4C3O[C@H](C(=O)NCCN4CCOCC4)[C@@H](O)[C@H]3O)c3ccccc32)c1 |
| InChI | InChI=1S/C35H42N8O5/c1-22-7-8-23(2)25(17-22)19-42-18-24(26-5-3-4-6-27(26)42)9-10-36-32-28-33(39-20-38-32)43(21-40-28)35-30(45)29(44)31(48-35)34(46)37-11-12-41-13-15-47-16-14-41/h3-8,17-18,20-21,29-31,35,44-45H,9-16,19H2,1-2H3,(H,37,46)(H,36,38,39)/t29-,30+,31-,35?/m0/s1 |
| InChIKey | KOLFVPKBVMXAHE-RZWYSUJCSA-N |
| XLogP | 2.17 |
| TPSA | 151.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.77 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |