C15H17N7O4S — CID 46876611
(3R,4S,5R)-2-[6-amino-2-[(2E)-2-(thiophen-3-ylmethylidene)hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 46876611) has the molecular formula C15H17N7O4S and a molecular weight of 391.41 g/mol. Its IUPAC name is (3R,4S,5R)-2-[6-amino-2-[(2E)-2-(thiophen-3-ylmethylidene)hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-[6-amino-2-[(2E)-2-(thiophen-3-ylmethylidene)hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 46876611 |
| Molecular Formula | C15H17N7O4S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (3R,4S,5R)-2-[6-amino-2-[(2E)-2-(thiophen-3-ylmethylidene)hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(N/N=C/c2ccsc2)nc2c1ncn2C1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H17N7O4S/c16-12-9-13(20-15(19-12)21-18-3-7-1-2-27-5-7)22(6-17-9)14-11(25)10(24)8(4-23)26-14/h1-3,5-6,8,10-11,14,23-25H,4H2,(H3,16,19,20,21)/b18-3+/t8-,10-,11-,14?/m1/s1 |
| InChIKey | PTFBGMKPBUSRAF-RBNPFDJUSA-N |
| XLogP | -0.47 |
| TPSA | 163.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|