C9H12O7 — CID 46876836
[(2R,3S,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]methyl 3-oxobutanoate (PubChem CID 46876836) has the molecular formula C9H12O7 and a molecular weight of 232.19 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]methyl 3-oxobutanoate.
| Compound Name | [(2R,3S,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]methyl 3-oxobutanoate |
|---|---|
| PubChem CID | 46876836 |
| Molecular Formula | C9H12O7 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | [(2R,3S,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]methyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OC[C@H]1OC(=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H12O7/c1-4(10)2-6(11)15-3-5-7(12)8(13)9(14)16-5/h5,7-8,12-13H,2-3H2,1H3/t5-,7-,8-/m1/s1 |
| InChIKey | BTTJSUNZFWDQFY-LPBLVHEISA-N |
| XLogP | -1.84 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|