C37H68O9 — CID 46876872
(3R,4R,5S)-3-[(2R,13R)-2,13-dihydroxy-13-[(2R,5S)-5-[(2S,5R)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]oxolan-2-yl]tridecyl]-3,4-dihydroxy-5-methyloxolan-2-one (PubChem CID 46876872) has the molecular formula C37H68O9 and a molecular weight of 656.94 g/mol. Its IUPAC name is (3R,4R,5S)-3-[(2R,13R)-2,13-dihydroxy-13-[(2R,5S)-5-[(2S,5R)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]oxolan-2-yl]tridecyl]-3,4-dihydroxy-5-methyloxolan-2-one.
| Compound Name | (3R,4R,5S)-3-[(2R,13R)-2,13-dihydroxy-13-[(2R,5S)-5-[(2S,5R)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]oxolan-2-yl]tridecyl]-3,4-dihydroxy-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 46876872 |
| Molecular Formula | C37H68O9 |
| Molecular Weight | 656.94 g/mol |
| Exact Mass | 656.49 |
| IUPAC Name | (3R,4R,5S)-3-[(2R,13R)-2,13-dihydroxy-13-[(2R,5S)-5-[(2S,5R)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]oxolan-2-yl]tridecyl]-3,4-dihydroxy-5-methyloxolan-2-one |
| SMILES | CCCCCCCCCC[C@H](O)[C@H]1CC[C@@H]([C@@H]2CC[C@H]([C@H](O)CCCCCCCCCC[C@@H](O)C[C@]3(O)C(=O)O[C@@H](C)[C@H]3O)O2)O1 |
| InChI | InChI=1S/C37H68O9/c1-3-4-5-6-7-11-14-17-20-29(39)31-22-24-33(45-31)34-25-23-32(46-34)30(40)21-18-15-12-9-8-10-13-16-19-28(38)26-37(43)35(41)27(2)44-36(37)42/h27-35,38-41,43H,3-26H2,1-2H3/t27-,28+,29-,30+,31+,32+,33-,34-,35+,37+/m0/s1 |
| InChIKey | SSGYQQLEDZKXBD-BCKGADQASA-N |
| XLogP | 6.02 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.94 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|