C28H33N3O — CID 46877765
(2S,5R)-1-[(S)-(3-methoxyphenyl)-(4-pyridin-2-ylphenyl)methyl]-2,5-dimethyl-4-prop-2-enylpiperazine (PubChem CID 46877765) has the molecular formula C28H33N3O and a molecular weight of 427.59 g/mol. Its IUPAC name is (2S,5R)-1-[(S)-(3-methoxyphenyl)-(4-pyridin-2-ylphenyl)methyl]-2,5-dimethyl-4-prop-2-enylpiperazine.
| Compound Name | (2S,5R)-1-[(S)-(3-methoxyphenyl)-(4-pyridin-2-ylphenyl)methyl]-2,5-dimethyl-4-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 46877765 |
| Molecular Formula | C28H33N3O |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (2S,5R)-1-[(S)-(3-methoxyphenyl)-(4-pyridin-2-ylphenyl)methyl]-2,5-dimethyl-4-prop-2-enylpiperazine |
| SMILES | C=CCN1C[C@H](C)N([C@@H](c2ccc(-c3ccccn3)cc2)c2cccc(OC)c2)C[C@H]1C |
| InChI | InChI=1S/C28H33N3O/c1-5-17-30-19-22(3)31(20-21(30)2)28(25-9-8-10-26(18-25)32-4)24-14-12-23(13-15-24)27-11-6-7-16-29-27/h5-16,18,21-22,28H,1,17,19-20H2,2-4H3/t21-,22+,28+/m1/s1 |
| InChIKey | ZDXWLVFBWXZKLT-WENCSYSZSA-N |
| XLogP | 5.43 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|