C33H38N6O5 — CID 46877814
(Z)-but-2-enedioic acid;7-[4-(4-methylpiperazin-1-yl)cyclohexyl]-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 46877814) has the molecular formula C33H38N6O5 and a molecular weight of 598.70 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;7-[4-(4-methylpiperazin-1-yl)cyclohexyl]-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | (Z)-but-2-enedioic acid;7-[4-(4-methylpiperazin-1-yl)cyclohexyl]-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 46877814 |
| Molecular Formula | C33H38N6O5 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | (Z)-but-2-enedioic acid;7-[4-(4-methylpiperazin-1-yl)cyclohexyl]-5-(4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CN1CCN(C2CCC(n3cc(-c4ccc(Oc5ccccc5)cc4)c4c(N)ncnc43)CC2)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C29H34N6O.C4H4O4/c1-33-15-17-34(18-16-33)22-9-11-23(12-10-22)35-19-26(27-28(30)31-20-32-29(27)35)21-7-13-25(14-8-21)36-24-5-3-2-4-6-24;5-3(6)1-2-4(7)8/h2-8,13-14,19-20,22-23H,9-12,15-18H2,1H3,(H2,30,31,32);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | BQGGVFIAYDVFNH-BTJKTKAUSA-N |
| XLogP | 4.92 |
| TPSA | 147.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|