C14H20N2O5 — CID 46877830
3-methyl-5-[(2R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-1,2-oxazole;oxalic acid (PubChem CID 46877830) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 3-methyl-5-[(2R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-1,2-oxazole;oxalic acid.
| Compound Name | 3-methyl-5-[(2R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-1,2-oxazole;oxalic acid |
|---|---|
| PubChem CID | 46877830 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 3-methyl-5-[(2R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-1,2-oxazole;oxalic acid |
| SMILES | Cc1cc([C@@H]2CC[C@H]3CCC2N3C)on1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H18N2O.C2H2O4/c1-8-7-12(15-13-8)10-5-3-9-4-6-11(10)14(9)2;3-1(4)2(5)6/h7,9-11H,3-6H2,1-2H3;(H,3,4)(H,5,6)/t9-,10+,11?;/m0./s1 |
| InChIKey | HPFKQYDKDHFAMG-SRSDLDAJSA-N |
| XLogP | 1.48 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|