C24H26N2O6 — CID 46877835
2-(4-nitrophenyl)ethyl (2R,3S,5R)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 46877835) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-(4-nitrophenyl)ethyl (2R,3S,5R)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | 2-(4-nitrophenyl)ethyl (2R,3S,5R)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 46877835 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-(4-nitrophenyl)ethyl (2R,3S,5R)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | CN1C2CC[C@@H]1C[C@H](OC(=O)c1ccccc1)[C@@H]2C(=O)OCCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H26N2O6/c1-25-19-11-12-20(25)22(21(15-19)32-23(27)17-5-3-2-4-6-17)24(28)31-14-13-16-7-9-18(10-8-16)26(29)30/h2-10,19-22H,11-15H2,1H3/t19-,20?,21+,22-/m1/s1 |
| InChIKey | XFDVAPZJHKZTNE-JGVPYUGNSA-N |
| XLogP | 3.39 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|