C26H32O9-2 — CID 46878384
2-[(3R,4R,5S)-4-[(1R,6S,8aR)-1-(furan-3-yl)-5,8a-dimethyl-3-oxo-4,6,7,8-tetrahydro-1H-isochromen-6-yl]-5-(carboxylatomethyl)-4-(hydroxymethyl)-2,2-dimethyloxolan-3-yl]acetate (PubChem CID 46878384) has the molecular formula C26H32O9-2 and a molecular weight of 488.53 g/mol. Its IUPAC name is 2-[(3R,4R,5S)-4-[(1R,6S,8aR)-1-(furan-3-yl)-5,8a-dimethyl-3-oxo-4,6,7,8-tetrahydro-1H-isochromen-6-yl]-5-(carboxylatomethyl)-4-(hydroxymethyl)-2,2-dimethyloxolan-3-yl]acetate.
| Compound Name | 2-[(3R,4R,5S)-4-[(1R,6S,8aR)-1-(furan-3-yl)-5,8a-dimethyl-3-oxo-4,6,7,8-tetrahydro-1H-isochromen-6-yl]-5-(carboxylatomethyl)-4-(hydroxymethyl)-2,2-dimethyloxolan-3-yl]acetate |
|---|---|
| PubChem CID | 46878384 |
| Molecular Formula | C26H32O9-2 |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-[(3R,4R,5S)-4-[(1R,6S,8aR)-1-(furan-3-yl)-5,8a-dimethyl-3-oxo-4,6,7,8-tetrahydro-1H-isochromen-6-yl]-5-(carboxylatomethyl)-4-(hydroxymethyl)-2,2-dimethyloxolan-3-yl]acetate |
| SMILES | CC1=C2CC(=O)O[C@@H](c3ccoc3)[C@]2(C)CC[C@@H]1[C@@]1(CO)[C@H](CC(=O)[O-])OC(C)(C)[C@@H]1CC(=O)[O-] |
| InChI | InChI=1S/C26H34O9/c1-14-16(5-7-25(4)17(14)9-22(32)34-23(25)15-6-8-33-12-15)26(13-27)18(10-20(28)29)24(2,3)35-19(26)11-21(30)31/h6,8,12,16,18-19,23,27H,5,7,9-11,13H2,1-4H3,(H,28,29)(H,30,31)/p-2/t16-,18-,19-,23-,25+,26+/m0/s1 |
| InChIKey | BQKCYOXFBVKBDA-DYNITIQCSA-L |
| XLogP | 1.05 |
| TPSA | 149.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|