C19H30ClNO — CID 46878511
(1S)-1-cyclopentyl-1-phenyl-3-piperidin-1-ylpropan-1-ol;hydrochloride (PubChem CID 46878511) has the molecular formula C19H30ClNO and a molecular weight of 323.91 g/mol. Its IUPAC name is (1S)-1-cyclopentyl-1-phenyl-3-piperidin-1-ylpropan-1-ol;hydrochloride.
| Compound Name | (1S)-1-cyclopentyl-1-phenyl-3-piperidin-1-ylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 46878511 |
| Molecular Formula | C19H30ClNO |
| Molecular Weight | 323.91 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (1S)-1-cyclopentyl-1-phenyl-3-piperidin-1-ylpropan-1-ol;hydrochloride |
| SMILES | Cl.O[C@](CCN1CCCCC1)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C19H29NO.ClH/c21-19(18-11-5-6-12-18,17-9-3-1-4-10-17)13-16-20-14-7-2-8-15-20;/h1,3-4,9-10,18,21H,2,5-8,11-16H2;1H/t19-;/m1./s1 |
| InChIKey | WBCWFMFZMRFRLT-FSRHSHDFSA-N |
| XLogP | 4.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.91 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |