C16H17N3O4 — CID 46878654
benzyl N-[(2R,3R,6S,7aS)-3-cyano-2-methyl-5-oxo-3,6,7,7a-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazol-6-yl]carbamate (PubChem CID 46878654) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is benzyl N-[(2R,3R,6S,7aS)-3-cyano-2-methyl-5-oxo-3,6,7,7a-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazol-6-yl]carbamate.
| Compound Name | benzyl N-[(2R,3R,6S,7aS)-3-cyano-2-methyl-5-oxo-3,6,7,7a-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazol-6-yl]carbamate |
|---|---|
| PubChem CID | 46878654 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | benzyl N-[(2R,3R,6S,7aS)-3-cyano-2-methyl-5-oxo-3,6,7,7a-tetrahydro-2H-pyrrolo[2,1-b][1,3]oxazol-6-yl]carbamate |
| SMILES | C[C@H]1O[C@H]2C[C@H](NC(=O)OCc3ccccc3)C(=O)N2[C@@H]1C#N |
| InChI | InChI=1S/C16H17N3O4/c1-10-13(8-17)19-14(23-10)7-12(15(19)20)18-16(21)22-9-11-5-3-2-4-6-11/h2-6,10,12-14H,7,9H2,1H3,(H,18,21)/t10-,12+,13-,14+/m1/s1 |
| InChIKey | MYAMCNICYAEFBU-CABNGKKXSA-N |
| XLogP | 1.15 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |