C22H22O — CID 46878683
(1R,7S,7aR)-4-methyl-1-naphthalen-1-yl-7-prop-1-en-2-yl-1,6,7,7a-tetrahydro-2-benzofuran (PubChem CID 46878683) has the molecular formula C22H22O and a molecular weight of 302.42 g/mol. Its IUPAC name is (1R,7S,7aR)-4-methyl-1-naphthalen-1-yl-7-prop-1-en-2-yl-1,6,7,7a-tetrahydro-2-benzofuran.
| Compound Name | (1R,7S,7aR)-4-methyl-1-naphthalen-1-yl-7-prop-1-en-2-yl-1,6,7,7a-tetrahydro-2-benzofuran |
|---|---|
| PubChem CID | 46878683 |
| Molecular Formula | C22H22O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (1R,7S,7aR)-4-methyl-1-naphthalen-1-yl-7-prop-1-en-2-yl-1,6,7,7a-tetrahydro-2-benzofuran |
| SMILES | C=C(C)[C@H]1CC=C(C)C2=CO[C@@H](c3cccc4ccccc34)[C@@H]21 |
| InChI | InChI=1S/C22H22O/c1-14(2)17-12-11-15(3)20-13-23-22(21(17)20)19-10-6-8-16-7-4-5-9-18(16)19/h4-11,13,17,21-22H,1,12H2,2-3H3/t17-,21-,22+/m1/s1 |
| InChIKey | FHDKKCYPMOPVOP-YHYVQYDKSA-N |
| XLogP | 5.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|