C16H19N3O2S — CID 46878696
benzyl N-[(3R,6R,8aS)-3-cyano-3,5,6,7,8,8a-hexahydro-2H-[1,3]thiazolo[3,2-a]pyridin-6-yl]carbamate (PubChem CID 46878696) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is benzyl N-[(3R,6R,8aS)-3-cyano-3,5,6,7,8,8a-hexahydro-2H-[1,3]thiazolo[3,2-a]pyridin-6-yl]carbamate.
| Compound Name | benzyl N-[(3R,6R,8aS)-3-cyano-3,5,6,7,8,8a-hexahydro-2H-[1,3]thiazolo[3,2-a]pyridin-6-yl]carbamate |
|---|---|
| PubChem CID | 46878696 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | benzyl N-[(3R,6R,8aS)-3-cyano-3,5,6,7,8,8a-hexahydro-2H-[1,3]thiazolo[3,2-a]pyridin-6-yl]carbamate |
| SMILES | N#C[C@@H]1CS[C@H]2CC[C@@H](NC(=O)OCc3ccccc3)CN12 |
| InChI | InChI=1S/C16H19N3O2S/c17-8-14-11-22-15-7-6-13(9-19(14)15)18-16(20)21-10-12-4-2-1-3-5-12/h1-5,13-15H,6-7,9-11H2,(H,18,20)/t13-,14-,15+/m1/s1 |
| InChIKey | BMTCKTDVNVYEEG-KFWWJZLASA-N |
| XLogP | 2.34 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |