C20H28O7 — CID 46878900
(1R,2S,3S,7S,9R,13R,14S,15R,16R,17S)-3,13,15,16-tetrahydroxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-5-ene-4,11-dione (PubChem CID 46878900) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is (1R,2S,3S,7S,9R,13R,14S,15R,16R,17S)-3,13,15,16-tetrahydroxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-5-ene-4,11-dione.
| Compound Name | (1R,2S,3S,7S,9R,13R,14S,15R,16R,17S)-3,13,15,16-tetrahydroxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-5-ene-4,11-dione |
|---|---|
| PubChem CID | 46878900 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (1R,2S,3S,7S,9R,13R,14S,15R,16R,17S)-3,13,15,16-tetrahydroxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-5-ene-4,11-dione |
| SMILES | CC1=CC(=O)[C@@H](O)[C@]2(C)[C@H]3[C@@H](O)[C@H](O)[C@H](C)[C@]4(O)CC(=O)O[C@H](C[C@@H]12)[C@]34C |
| InChI | InChI=1S/C20H28O7/c1-8-5-11(21)17(25)18(3)10(8)6-12-19(4)16(18)15(24)14(23)9(2)20(19,26)7-13(22)27-12/h5,9-10,12,14-17,23-26H,6-7H2,1-4H3/t9-,10-,12+,14+,15-,16+,17+,18-,19+,20+/m0/s1 |
| InChIKey | QQHDMRQEBBKJIQ-FYMUVSDDSA-N |
| XLogP | -0.06 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |